C22H18ClF3N4O2 — CID 94836882
N-(2-chlorophenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide (PubChem CID 94836882) has the molecular formula C22H18ClF3N4O2 and a molecular weight of 462.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 94836882 |
| Molecular Formula | C22H18ClF3N4O2 |
| Molecular Weight | 462.86 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)Nc2ccccc2Cl)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H18ClF3N4O2/c1-13-11-15(14(2)30(13)19-10-6-3-7-16(19)22(24,25)26)12-27-29-21(32)20(31)28-18-9-5-4-8-17(18)23/h3-12H,1-2H3,(H,28,31)(H,29,32)/b27-12- |
| InChIKey | IIKFGAAHXJODQG-PPDIBHTLSA-N |
| XLogP | 4.86 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|