C18H17Cl2N3O2 — CID 6871449
N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2,4,6-trimethylphenyl)oxamide (PubChem CID 6871449) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 6871449 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)N/N=C/c2ccc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-10-6-11(2)16(12(3)7-10)22-17(24)18(25)23-21-9-13-4-5-14(19)8-15(13)20/h4-9H,1-3H3,(H,22,24)(H,23,25)/b21-9+ |
| InChIKey | XYYQCRURXVACSH-ZVBGSRNCSA-N |
| XLogP | 4.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|