C8H6Cl2N2O2 — CID 70469242
[(2,4-dichlorophenyl)methylideneamino]carbamic acid (PubChem CID 70469242) has the molecular formula C8H6Cl2N2O2 and a molecular weight of 233.05 g/mol. Its IUPAC name is [(2,4-dichlorophenyl)methylideneamino]carbamic acid.
| Compound Name | [(2,4-dichlorophenyl)methylideneamino]carbamic acid |
|---|---|
| PubChem CID | 70469242 |
| Molecular Formula | C8H6Cl2N2O2 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | [(2,4-dichlorophenyl)methylideneamino]carbamic acid |
| SMILES | O=C(O)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2N2O2/c9-6-2-1-5(7(10)3-6)4-11-12-8(13)14/h1-4,12H,(H,13,14) |
| InChIKey | MUQCVSRFTHZASX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|