C14H9Cl2FN2O — CID 6299939
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-fluorobenzamide (PubChem CID 6299939) has the molecular formula C14H9Cl2FN2O and a molecular weight of 311.14 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-fluorobenzamide.
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 6299939 |
| Molecular Formula | C14H9Cl2FN2O |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-fluorobenzamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)c1ccccc1F |
| InChI | InChI=1S/C14H9Cl2FN2O/c15-10-6-5-9(12(16)7-10)8-18-19-14(20)11-3-1-2-4-13(11)17/h1-8H,(H,19,20)/b18-8- |
| InChIKey | BTULPVSHXNXLHZ-LSCVHKIXSA-N |
| XLogP | 3.90 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|