C20H14Cl3N3O3S — CID 6154481
2-[(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide (PubChem CID 6154481) has the molecular formula C20H14Cl3N3O3S and a molecular weight of 482.78 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6154481 |
| Molecular Formula | C20H14Cl3N3O3S |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl3N3O3S/c21-14-7-9-16(10-8-14)30(28,29)26-19-4-2-1-3-17(19)20(27)25-24-12-13-5-6-15(22)11-18(13)23/h1-12,26H,(H,25,27)/b24-12- |
| InChIKey | VQACYONAEXKZSW-MSXFZWOLSA-N |
| XLogP | 5.21 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|