C24H18ClN3O4S — CID 135683070
2-[(4-chlorophenyl)sulfonylamino]-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 135683070) has the molecular formula C24H18ClN3O4S and a molecular weight of 479.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135683070 |
| Molecular Formula | C24H18ClN3O4S |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1c(O)ccc2ccccc12)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18ClN3O4S/c25-17-10-12-18(13-11-17)33(31,32)28-22-8-4-3-7-20(22)24(30)27-26-15-21-19-6-2-1-5-16(19)9-14-23(21)29/h1-15,28-29H,(H,27,30)/b26-15+ |
| InChIKey | DTNAZOATSYCQLH-CVKSISIWSA-N |
| XLogP | 4.76 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|