C31H21Cl2N3O5S — CID 3331599
[1-[[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate (PubChem CID 3331599) has the molecular formula C31H21Cl2N3O5S and a molecular weight of 618.50 g/mol. Its IUPAC name is [1-[[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate.
| Compound Name | [1-[[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 3331599 |
| Molecular Formula | C31H21Cl2N3O5S |
| Molecular Weight | 618.50 g/mol |
| Exact Mass | 617.06 |
| IUPAC Name | [1-[[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1C=NNC(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C31H21Cl2N3O5S/c32-21-14-16-22(17-15-21)42(39,40)36-28-12-6-4-10-25(28)30(37)35-34-19-26-23-8-2-1-7-20(23)13-18-29(26)41-31(38)24-9-3-5-11-27(24)33/h1-19,36H,(H,35,37) |
| InChIKey | HLOQTFZZFXFOLA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|