C33H22N2O4 — CID 46500871
[1-[(E)-[(1-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate (PubChem CID 46500871) has the molecular formula C33H22N2O4 and a molecular weight of 510.55 g/mol. Its IUPAC name is [1-[(E)-[(1-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate.
| Compound Name | [1-[(E)-[(1-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 46500871 |
| Molecular Formula | C33H22N2O4 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | [1-[(E)-[(1-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate |
| SMILES | O=C(N/N=C/c1c(OC(=O)c2cccc3ccccc23)ccc2ccccc12)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C33H22N2O4/c36-31-26-14-6-3-10-23(26)16-18-28(31)32(37)35-34-20-29-25-13-5-2-9-22(25)17-19-30(29)39-33(38)27-15-7-11-21-8-1-4-12-24(21)27/h1-20,36H,(H,35,37)/b34-20+ |
| InChIKey | SSOHRNIUTIOVFA-QXUDOOCXSA-N |
| XLogP | 6.83 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|