C24H15Cl2N3O3 — CID 4987854
[1-[(pyridine-4-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 4987854) has the molecular formula C24H15Cl2N3O3 and a molecular weight of 464.31 g/mol. Its IUPAC name is [1-[(pyridine-4-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[(pyridine-4-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4987854 |
| Molecular Formula | C24H15Cl2N3O3 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | [1-[(pyridine-4-carbonylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | O=C(NN=Cc1c(OC(=O)c2ccc(Cl)cc2Cl)ccc2ccccc12)c1ccncc1 |
| InChI | InChI=1S/C24H15Cl2N3O3/c25-17-6-7-19(21(26)13-17)24(31)32-22-8-5-15-3-1-2-4-18(15)20(22)14-28-29-23(30)16-9-11-27-12-10-16/h1-14H,(H,29,30) |
| InChIKey | SABBXZOOSAGQEK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|