C27H17Cl4N3O4 — CID 3760583
[1-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 3760583) has the molecular formula C27H17Cl4N3O4 and a molecular weight of 589.26 g/mol. Its IUPAC name is [1-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3760583 |
| Molecular Formula | C27H17Cl4N3O4 |
| Molecular Weight | 589.26 g/mol |
| Exact Mass | 587.00 |
| IUPAC Name | [1-[[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)NN=Cc1c(OC(=O)c2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C27H17Cl4N3O4/c28-17-7-8-19(22(30)12-17)27(37)38-24-10-6-15-3-1-2-4-18(15)20(24)13-33-34-25(35)14-32-26(36)16-5-9-21(29)23(31)11-16/h1-13H,14H2,(H,32,36)(H,34,35) |
| InChIKey | PTJDABIJJCQODH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.26 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|