C27H18Cl3N3O4 — CID 6247941
[1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate (PubChem CID 6247941) has the molecular formula C27H18Cl3N3O4 and a molecular weight of 554.82 g/mol. Its IUPAC name is [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate.
| Compound Name | [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6247941 |
| Molecular Formula | C27H18Cl3N3O4 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)N/N=C\c1c(OC(=O)c2ccccc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C27H18Cl3N3O4/c28-21-8-4-3-7-19(21)27(36)37-24-12-10-16-5-1-2-6-18(16)20(24)14-32-33-25(34)15-31-26(35)17-9-11-22(29)23(30)13-17/h1-14H,15H2,(H,31,35)(H,33,34)/b32-14- |
| InChIKey | JIHRAIYUIIDVNP-LPEPFOFCSA-N |
| XLogP | 5.90 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|