C30H26ClN3O7 — CID 4319339
[1-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate (PubChem CID 4319339) has the molecular formula C30H26ClN3O7 and a molecular weight of 576.01 g/mol. Its IUPAC name is [1-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate.
| Compound Name | [1-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4319339 |
| Molecular Formula | C30H26ClN3O7 |
| Molecular Weight | 576.01 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | [1-[[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| SMILES | COc1cc(C(=O)NCC(=O)NN=Cc2c(OC(=O)c3ccccc3Cl)ccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C30H26ClN3O7/c1-38-25-14-19(15-26(39-2)28(25)40-3)29(36)32-17-27(35)34-33-16-22-20-9-5-4-8-18(20)12-13-24(22)41-30(37)21-10-6-7-11-23(21)31/h4-16H,17H2,1-3H3,(H,32,36)(H,34,35) |
| InChIKey | LRYPLDQJHBHPBB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.01 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|