C30H27N3O6 — CID 3845692
[1-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate (PubChem CID 3845692) has the molecular formula C30H27N3O6 and a molecular weight of 525.56 g/mol. Its IUPAC name is [1-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate.
| Compound Name | [1-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3845692 |
| Molecular Formula | C30H27N3O6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [1-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2C=NNC(=O)CNC(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C30H27N3O6/c1-19-8-10-21(11-9-19)29(35)31-18-28(34)33-32-17-24-23-7-5-4-6-20(23)12-14-25(24)39-30(36)22-13-15-26(37-2)27(16-22)38-3/h4-17H,18H2,1-3H3,(H,31,35)(H,33,34) |
| InChIKey | WTIGYVPECNHFNC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|