C29H24ClN3O6 — CID 3725273
[1-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate (PubChem CID 3725273) has the molecular formula C29H24ClN3O6 and a molecular weight of 545.98 g/mol. Its IUPAC name is [1-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate.
| Compound Name | [1-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 3725273 |
| Molecular Formula | C29H24ClN3O6 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | [1-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| SMILES | COc1ccc(C(=O)NCC(=O)NN=Cc2c(OC(=O)c3ccccc3Cl)ccc3ccccc23)cc1OC |
| InChI | InChI=1S/C29H24ClN3O6/c1-37-25-14-12-19(15-26(25)38-2)28(35)31-17-27(34)33-32-16-22-20-8-4-3-7-18(20)11-13-24(22)39-29(36)21-9-5-6-10-23(21)30/h3-16H,17H2,1-2H3,(H,31,35)(H,33,34) |
| InChIKey | ZERFDIDARJOYLC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|