C28H22ClN3O5 — CID 3493136
[1-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate (PubChem CID 3493136) has the molecular formula C28H22ClN3O5 and a molecular weight of 515.95 g/mol. Its IUPAC name is [1-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate.
| Compound Name | [1-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3493136 |
| Molecular Formula | C28H22ClN3O5 |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | [1-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2C=NNC(=O)CNC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C28H22ClN3O5/c1-36-22-12-9-19(10-13-22)28(35)37-25-14-11-18-5-2-3-8-23(18)24(25)16-31-32-26(33)17-30-27(34)20-6-4-7-21(29)15-20/h2-16H,17H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | VRQUPMDLVCVXBD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|