C24H14Cl3NO2 — CID 3950984
[1-[(2-chlorophenyl)iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 3950984) has the molecular formula C24H14Cl3NO2 and a molecular weight of 454.74 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[(2-chlorophenyl)iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3950984 |
| Molecular Formula | C24H14Cl3NO2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | [1-[(2-chlorophenyl)iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1/C=N/c1ccccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H14Cl3NO2/c25-16-10-11-18(21(27)13-16)24(29)30-23-12-9-15-5-1-2-6-17(15)19(23)14-28-22-8-4-3-7-20(22)26/h1-14H/b28-14+ |
| InChIKey | RAHQLPXYKXZYCA-CCVNUDIWSA-N |
| XLogP | 7.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|