C50H32Cl4N2O4 — CID 171980369
[1-[[4-[4-[[2-(2,4-dichlorobenzoyl)oxynaphthalen-1-yl]methylideneamino]-2-methylphenyl]-3-methylphenyl]iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 171980369) has the molecular formula C50H32Cl4N2O4 and a molecular weight of 866.63 g/mol. Its IUPAC name is [1-[[4-[4-[[2-(2,4-dichlorobenzoyl)oxynaphthalen-1-yl]methylideneamino]-2-methylphenyl]-3-methylphenyl]iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[[4-[4-[[2-(2,4-dichlorobenzoyl)oxynaphthalen-1-yl]methylideneamino]-2-methylphenyl]-3-methylphenyl]iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 171980369 |
| Molecular Formula | C50H32Cl4N2O4 |
| Molecular Weight | 866.63 g/mol |
| Exact Mass | 864.11 |
| IUPAC Name | [1-[[4-[4-[[2-(2,4-dichlorobenzoyl)oxynaphthalen-1-yl]methylideneamino]-2-methylphenyl]-3-methylphenyl]iminomethyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | Cc1cc(/N=C/c2c(OC(=O)c3ccc(Cl)cc3Cl)ccc3ccccc23)ccc1-c1ccc(/N=C/c2c(OC(=O)c3ccc(Cl)cc3Cl)ccc3ccccc23)cc1C |
| InChI | InChI=1S/C50H32Cl4N2O4/c1-29-23-35(55-27-43-39-9-5-3-7-31(39)11-21-47(43)59-49(57)41-17-13-33(51)25-45(41)53)15-19-37(29)38-20-16-36(24-30(38)2)56-28-44-40-10-6-4-8-32(40)12-22-48(44)60-50(58)42-18-14-34(52)26-46(42)54/h3-28H,1-2H3/b55-27+,56-28+ |
| InChIKey | AGSFJVPCFRNXRB-SVSGDSPVSA-N |
| XLogP | 14.83 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.63 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|