C25H18Cl3NO — CID 126223343
N-(3-chloro-4-methylphenyl)-1-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methanimine (PubChem CID 126223343) has the molecular formula C25H18Cl3NO and a molecular weight of 454.78 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methanimine.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 126223343 |
| Molecular Formula | C25H18Cl3NO |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methanimine |
| SMILES | Cc1ccc(/N=C/c2c(OCc3ccc(Cl)cc3Cl)ccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C25H18Cl3NO/c1-16-6-10-20(13-23(16)27)29-14-22-21-5-3-2-4-17(21)8-11-25(22)30-15-18-7-9-19(26)12-24(18)28/h2-14H,15H2,1H3/b29-14+ |
| InChIKey | SNAPAEKDMIRWKI-IPPBACCNSA-N |
| XLogP | 8.44 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|