C26H21ClN2O2 — CID 126215966
N-(3-chloro-4-methylphenyl)-2-[1-(phenyliminomethyl)naphthalen-2-yl]oxyacetamide (PubChem CID 126215966) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[1-(phenyliminomethyl)naphthalen-2-yl]oxyacetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[1-(phenyliminomethyl)naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 126215966 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[1-(phenyliminomethyl)naphthalen-2-yl]oxyacetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc3ccccc3c2/C=N/c2ccccc2)cc1Cl |
| InChI | InChI=1S/C26H21ClN2O2/c1-18-11-13-21(15-24(18)27)29-26(30)17-31-25-14-12-19-7-5-6-10-22(19)23(25)16-28-20-8-3-2-4-9-20/h2-16H,17H2,1H3,(H,29,30)/b28-16+ |
| InChIKey | HVOBKLSLVFFHTO-LQKURTRISA-N |
| XLogP | 6.57 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|