C23H19Cl3N2O2 — CID 126218997
2-[4-chloro-2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 126218997) has the molecular formula C23H19Cl3N2O2 and a molecular weight of 461.78 g/mol. Its IUPAC name is 2-[4-chloro-2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126218997 |
| Molecular Formula | C23H19Cl3N2O2 |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 2-[4-chloro-2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(/N=C/c2cc(Cl)ccc2OCC(=O)Nc2ccc(C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C23H19Cl3N2O2/c1-14-3-6-18(10-20(14)25)27-12-16-9-17(24)5-8-22(16)30-13-23(29)28-19-7-4-15(2)21(26)11-19/h3-12H,13H2,1-2H3,(H,28,29)/b27-12+ |
| InChIKey | RGASMJQBYPOKRS-KKMKTNMSSA-N |
| XLogP | 7.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|