C24H23ClN2O2 — CID 126222975
2-[4-chloro-2-[(3,4-dimethylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126222975) has the molecular formula C24H23ClN2O2 and a molecular weight of 406.91 g/mol. Its IUPAC name is 2-[4-chloro-2-[(3,4-dimethylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(3,4-dimethylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126222975 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[4-chloro-2-[(3,4-dimethylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Cl)cc2/C=N/c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H23ClN2O2/c1-16-5-4-6-22(11-16)27-24(28)15-29-23-10-8-20(25)13-19(23)14-26-21-9-7-17(2)18(3)12-21/h4-14H,15H2,1-3H3,(H,27,28)/b26-14+ |
| InChIKey | OJSRMTALPRVLKU-VULFUBBASA-N |
| XLogP | 6.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|