C27H28ClN3O5 — CID 126329764
N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126329764) has the molecular formula C27H28ClN3O5 and a molecular weight of 509.99 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126329764 |
| Molecular Formula | C27H28ClN3O5 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2OCC(=O)Nc2cccc(C)c2)cc1OCC |
| InChI | InChI=1S/C27H28ClN3O5/c1-4-34-24-11-9-19(15-25(24)35-5-2)27(33)31-29-16-20-14-21(28)10-12-23(20)36-17-26(32)30-22-8-6-7-18(3)13-22/h6-16H,4-5,17H2,1-3H3,(H,30,32)(H,31,33)/b29-16+ |
| InChIKey | OSRJCZIVGQDKED-MUFRIFMGSA-N |
| XLogP | 5.23 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|