C24H22ClN3O4 — CID 126259967
N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide (PubChem CID 126259967) has the molecular formula C24H22ClN3O4 and a molecular weight of 451.91 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 126259967 |
| Molecular Formula | C24H22ClN3O4 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[(E)-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C/c2cc(Cl)ccc2OCC(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C24H22ClN3O4/c1-16-5-3-7-20(11-16)27-23(29)15-32-22-10-9-19(25)12-18(22)14-26-28-24(30)17-6-4-8-21(13-17)31-2/h3-14H,15H2,1-2H3,(H,27,29)(H,28,30)/b26-14+ |
| InChIKey | GUDCGFVQIBEAEW-VULFUBBASA-N |
| XLogP | 4.44 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|