C21H20ClNO6 — CID 126056010
dimethyl 2-[[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]propanedioate (PubChem CID 126056010) has the molecular formula C21H20ClNO6 and a molecular weight of 417.85 g/mol. Its IUPAC name is dimethyl 2-[[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 126056010 |
| Molecular Formula | C21H20ClNO6 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | dimethyl 2-[[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1cc(Cl)ccc1OCC(=O)Nc1cccc(C)c1)C(=O)OC |
| InChI | InChI=1S/C21H20ClNO6/c1-13-5-4-6-16(9-13)23-19(24)12-29-18-8-7-15(22)10-14(18)11-17(20(25)27-2)21(26)28-3/h4-11H,12H2,1-3H3,(H,23,24) |
| InChIKey | WZLINYITZURYOV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|