C23H21ClN2O2 — CID 126220488
2-[2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126220488) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-[2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126220488 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[2-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccccc2/C=N/c2ccc(C)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H21ClN2O2/c1-16-6-5-8-20(12-16)26-23(27)15-28-22-9-4-3-7-18(22)14-25-19-11-10-17(2)21(24)13-19/h3-14H,15H2,1-2H3,(H,26,27)/b25-14+ |
| InChIKey | WMKWBXADEMRPFU-AFUMVMLFSA-N |
| XLogP | 5.72 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|