C27H22Cl2N2O2 — CID 126214851
N-(3-chloro-4-methylphenyl)-2-[1-[(3-chloro-4-methylphenyl)iminomethyl]naphthalen-2-yl]oxyacetamide (PubChem CID 126214851) has the molecular formula C27H22Cl2N2O2 and a molecular weight of 477.39 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[1-[(3-chloro-4-methylphenyl)iminomethyl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[1-[(3-chloro-4-methylphenyl)iminomethyl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 126214851 |
| Molecular Formula | C27H22Cl2N2O2 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[1-[(3-chloro-4-methylphenyl)iminomethyl]naphthalen-2-yl]oxyacetamide |
| SMILES | Cc1ccc(/N=C/c2c(OCC(=O)Nc3ccc(C)c(Cl)c3)ccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C27H22Cl2N2O2/c1-17-7-10-20(13-24(17)28)30-15-23-22-6-4-3-5-19(22)9-12-26(23)33-16-27(32)31-21-11-8-18(2)25(29)14-21/h3-15H,16H2,1-2H3,(H,31,32)/b30-15+ |
| InChIKey | DDJLYPBTKVIMIS-FJEPWZHXSA-N |
| XLogP | 7.53 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|