C24H21Br2ClN2O2 — CID 126214545
N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(4-ethylphenyl)iminomethyl]phenoxy]acetamide (PubChem CID 126214545) has the molecular formula C24H21Br2ClN2O2 and a molecular weight of 564.71 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(4-ethylphenyl)iminomethyl]phenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(4-ethylphenyl)iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126214545 |
| Molecular Formula | C24H21Br2ClN2O2 |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 561.97 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(4-ethylphenyl)iminomethyl]phenoxy]acetamide |
| SMILES | CCc1ccc(/N=C/c2cc(Br)c(OCC(=O)Nc3ccc(C)c(Cl)c3)c(Br)c2)cc1 |
| InChI | InChI=1S/C24H21Br2ClN2O2/c1-3-16-5-8-18(9-6-16)28-13-17-10-20(25)24(21(26)11-17)31-14-23(30)29-19-7-4-15(2)22(27)12-19/h4-13H,3,14H2,1-2H3,(H,29,30)/b28-13+ |
| InChIKey | ARWSKMNSQNSITQ-XODNFHPESA-N |
| XLogP | 7.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|