C23H18Br2ClN3O3 — CID 126258195
N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126258195) has the molecular formula C23H18Br2ClN3O3 and a molecular weight of 579.68 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126258195 |
| Molecular Formula | C23H18Br2ClN3O3 |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 576.94 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(/C=N/NC(=O)c3ccccc3)cc2Br)cc1Cl |
| InChI | InChI=1S/C23H18Br2ClN3O3/c1-14-7-8-17(11-20(14)26)28-21(30)13-32-22-18(24)9-15(10-19(22)25)12-27-29-23(31)16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H,28,30)(H,29,31)/b27-12+ |
| InChIKey | BDMXWAMPCJFVBU-KKMKTNMSSA-N |
| XLogP | 5.95 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|