C25H23Br2N3O3 — CID 126269617
N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-methylbenzamide (PubChem CID 126269617) has the molecular formula C25H23Br2N3O3 and a molecular weight of 573.29 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 126269617 |
| Molecular Formula | C25H23Br2N3O3 |
| Molecular Weight | 573.29 g/mol |
| Exact Mass | 571.01 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3ccc(C)c(C)c3)c(Br)c2)cc1 |
| InChI | InChI=1S/C25H23Br2N3O3/c1-15-4-7-19(8-5-15)25(32)30-28-13-18-11-21(26)24(22(27)12-18)33-14-23(31)29-20-9-6-16(2)17(3)10-20/h4-13H,14H2,1-3H3,(H,29,31)(H,30,32)/b28-13+ |
| InChIKey | JGDNODWLKPEDIO-XODNFHPESA-N |
| XLogP | 5.92 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|