C24H20Br2N4O5 — CID 126262075
N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 126262075) has the molecular formula C24H20Br2N4O5 and a molecular weight of 604.26 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126262075 |
| Molecular Formula | C24H20Br2N4O5 |
| Molecular Weight | 604.26 g/mol |
| Exact Mass | 601.98 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(/C=N/NC(=O)c3cccc([N+](=O)[O-])c3)cc2Br)cc1C |
| InChI | InChI=1S/C24H20Br2N4O5/c1-14-6-7-18(8-15(14)2)28-22(31)13-35-23-20(25)9-16(10-21(23)26)12-27-29-24(32)17-4-3-5-19(11-17)30(33)34/h3-12H,13H2,1-2H3,(H,28,31)(H,29,32)/b27-12+ |
| InChIKey | LSSZJXMAJUVSJJ-KKMKTNMSSA-N |
| XLogP | 5.52 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|