C16H12Br2N4O5 — CID 126270832
N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 126270832) has the molecular formula C16H12Br2N4O5 and a molecular weight of 500.10 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126270832 |
| Molecular Formula | C16H12Br2N4O5 |
| Molecular Weight | 500.10 g/mol |
| Exact Mass | 497.92 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | NC(=O)COc1c(Br)cc(/C=N/NC(=O)c2cccc([N+](=O)[O-])c2)cc1Br |
| InChI | InChI=1S/C16H12Br2N4O5/c17-12-4-9(5-13(18)15(12)27-8-14(19)23)7-20-21-16(24)10-2-1-3-11(6-10)22(25)26/h1-7H,8H2,(H2,19,23)(H,21,24)/b20-7+ |
| InChIKey | QWXDMYAUYHWFSW-IFRROFPPSA-N |
| XLogP | 2.75 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.10 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|