C17H15Br2N3O4 — CID 126273928
N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-methoxybenzamide (PubChem CID 126273928) has the molecular formula C17H15Br2N3O4 and a molecular weight of 485.13 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 126273928 |
| Molecular Formula | C17H15Br2N3O4 |
| Molecular Weight | 485.13 g/mol |
| Exact Mass | 482.94 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3,5-dibromophenyl]methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C/c2cc(Br)c(OCC(N)=O)c(Br)c2)c1 |
| InChI | InChI=1S/C17H15Br2N3O4/c1-25-12-4-2-3-11(7-12)17(24)22-21-8-10-5-13(18)16(14(19)6-10)26-9-15(20)23/h2-8H,9H2,1H3,(H2,20,23)(H,22,24)/b21-8+ |
| InChIKey | WDVCFRSYPWZQSO-ODCIPOBUSA-N |
| XLogP | 2.85 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.13 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|