C18H17Br2N3O4 — CID 126276252
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-bromobenzamide (PubChem CID 126276252) has the molecular formula C18H17Br2N3O4 and a molecular weight of 499.16 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-bromobenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-bromobenzamide |
|---|---|
| PubChem CID | 126276252 |
| Molecular Formula | C18H17Br2N3O4 |
| Molecular Weight | 499.16 g/mol |
| Exact Mass | 496.96 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-bromobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(Br)cc2)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C18H17Br2N3O4/c1-2-26-15-8-11(7-14(20)17(15)27-10-16(21)24)9-22-23-18(25)12-3-5-13(19)6-4-12/h3-9H,2,10H2,1H3,(H2,21,24)(H,23,25)/b22-9+ |
| InChIKey | BZJHSIHYRDSHQQ-LSFURLLWSA-N |
| XLogP | 3.24 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|