C20H23BrN4O4 — CID 6909100
4-amino-N-[(E)-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide (PubChem CID 6909100) has the molecular formula C20H23BrN4O4 and a molecular weight of 463.33 g/mol. Its IUPAC name is 4-amino-N-[(E)-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-amino-N-[(E)-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6909100 |
| Molecular Formula | C20H23BrN4O4 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 4-amino-N-[(E)-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(N)cc2)cc(Br)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C20H23BrN4O4/c1-4-28-17-10-13(9-16(21)19(17)29-12-18(26)25(2)3)11-23-24-20(27)14-5-7-15(22)8-6-14/h5-11H,4,12,22H2,1-3H3,(H,24,27)/b23-11+ |
| InChIKey | UEJPQLVIUPVLLL-FOKLQQMPSA-N |
| XLogP | 2.66 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|