C24H21IN4O6 — CID 126261536
N-[(E)-[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 126261536) has the molecular formula C24H21IN4O6 and a molecular weight of 588.36 g/mol. Its IUPAC name is N-[(E)-[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126261536 |
| Molecular Formula | C24H21IN4O6 |
| Molecular Weight | 588.36 g/mol |
| Exact Mass | 588.05 |
| IUPAC Name | N-[(E)-[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cccc([N+](=O)[O-])c2)cc(I)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C24H21IN4O6/c1-15-5-3-7-18(9-15)27-22(30)14-35-23-20(25)10-16(11-21(23)34-2)13-26-28-24(31)17-6-4-8-19(12-17)29(32)33/h3-13H,14H2,1-2H3,(H,27,30)(H,28,31)/b26-13+ |
| InChIKey | JTEVJIBELKZYMJ-LGJNPRDNSA-N |
| XLogP | 4.30 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|