C26H26IN3O5 — CID 126268898
N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3-methoxybenzamide (PubChem CID 126268898) has the molecular formula C26H26IN3O5 and a molecular weight of 587.41 g/mol. Its IUPAC name is N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 126268898 |
| Molecular Formula | C26H26IN3O5 |
| Molecular Weight | 587.41 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | N-[(E)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C/c2cc(I)c(OCC(=O)Nc3ccc(C)cc3C)c(OC)c2)c1 |
| InChI | InChI=1S/C26H26IN3O5/c1-16-8-9-22(17(2)10-16)29-24(31)15-35-25-21(27)11-18(12-23(25)34-4)14-28-30-26(32)19-6-5-7-20(13-19)33-3/h5-14H,15H2,1-4H3,(H,29,31)(H,30,32)/b28-14+ |
| InChIKey | JRPLEKGAVBWPMS-CCVNUDIWSA-N |
| XLogP | 4.71 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|