C25H24ClN3O4 — CID 126262426
N-[(E)-[3-chloro-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide (PubChem CID 126262426) has the molecular formula C25H24ClN3O4 and a molecular weight of 465.94 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 126262426 |
| Molecular Formula | C25H24ClN3O4 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[(E)-[3-chloro-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C/c2ccc(OCC(=O)Nc3cc(C)ccc3C)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H24ClN3O4/c1-16-7-8-17(2)22(11-16)28-24(30)15-33-23-10-9-18(12-21(23)26)14-27-29-25(31)19-5-4-6-20(13-19)32-3/h4-14H,15H2,1-3H3,(H,28,30)(H,29,31)/b27-14+ |
| InChIKey | KXGWFKSFIQSADO-MZJWZYIUSA-N |
| XLogP | 4.75 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|