About N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide
N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 3900181) has the molecular formula C24H23N3O3
and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
Molecular Properties
| Compound Name | N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| PubChem CID | 3900181 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(C)c(NC(=O)COc2ccc(C=NNC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H23N3O3/c1-17-8-9-18(2)22(14-17)26-23(28)16-30-21-12-10-19(11-13-21)15-25-27-24(29)20-6-4-3-5-7-20/h3-15H,16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | ODENNKJJIGBXLI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide?
The IUPAC name of N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (CID 3900181) is N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
What is the SMILES notation for N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide?
The canonical SMILES for N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide is Cc1ccc(C)c(NC(=O)COc2ccc(C=NNC(=O)c3ccccc3)cc2)c1.
What is the InChIKey of N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide?
The InChIKey is ODENNKJJIGBXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O3/c1-17-8-9-18(2)22(14-17)26-23(28)16-30-21-12-10-19(11-13-21)15-25-27-24(29)20-6-4-3-5-7-20/h3-15H,16H2,1-2H3,(H,26,28)(H,27,29).
What are the key properties of N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide?
N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide has a molecular weight of 401.47 g/mol, XLogP of 4.08, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide is sourced from PubChem (CID 3900181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).