C32H29BrClN3O6 — CID 126337604
N-[(E)-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 126337604) has the molecular formula C32H29BrClN3O6 and a molecular weight of 666.96 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126337604 |
| Molecular Formula | C32H29BrClN3O6 |
| Molecular Weight | 666.96 g/mol |
| Exact Mass | 665.09 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3ccc(C)c(Cl)c3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H29BrClN3O6/c1-20-9-11-24(16-26(20)34)36-30(38)19-43-31-25(33)13-22(14-29(31)41-3)17-35-37-32(39)23-10-12-27(28(15-23)40-2)42-18-21-7-5-4-6-8-21/h4-17H,18-19H2,1-3H3,(H,36,38)(H,37,39)/b35-17+ |
| InChIKey | DHNXVWQOFSZAOO-XJECJHNESA-N |
| XLogP | 6.79 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.96 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|