C32H28Br2ClN3O5 — CID 126275105
N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126275105) has the molecular formula C32H28Br2ClN3O5 and a molecular weight of 729.85 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126275105 |
| Molecular Formula | C32H28Br2ClN3O5 |
| Molecular Weight | 729.85 g/mol |
| Exact Mass | 727.01 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3ccc(C)c(Cl)c3)c(Br)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H28Br2ClN3O5/c1-3-41-29-15-23(10-12-28(29)42-18-21-7-5-4-6-8-21)32(40)38-36-17-22-13-25(33)31(26(34)14-22)43-19-30(39)37-24-11-9-20(2)27(35)16-24/h4-17H,3,18-19H2,1-2H3,(H,37,39)(H,38,40)/b36-17+ |
| InChIKey | ZXESDSBDFMLXHV-KULFSUQXSA-N |
| XLogP | 7.93 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.85 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|