C27H27ClN4O4 — CID 3928774
N-(3-chloro-4-methylphenyl)-N'-[[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 3928774) has the molecular formula C27H27ClN4O4 and a molecular weight of 506.99 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-[[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-[[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 3928774 |
| Molecular Formula | C27H27ClN4O4 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-[[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2ccccc2C=NNC(=O)C(=O)Nc2ccc(C)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C27H27ClN4O4/c1-16-11-18(3)25(19(4)12-16)31-24(33)15-36-23-8-6-5-7-20(23)14-29-32-27(35)26(34)30-21-10-9-17(2)22(28)13-21/h5-14H,15H2,1-4H3,(H,30,34)(H,31,33)(H,32,35) |
| InChIKey | JMQIFFLVLSCJRU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|