C28H30N4O4 — CID 126176448
N'-[(Z)-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide (PubChem CID 126176448) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide.
| Compound Name | N'-[(Z)-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 126176448 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N'-[(Z)-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2ccccc2/C=N\NC(=O)C(=O)NCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H30N4O4/c1-19-15-20(2)26(21(3)16-19)31-25(33)18-36-24-12-8-7-11-23(24)17-30-32-28(35)27(34)29-14-13-22-9-5-4-6-10-22/h4-12,15-17H,13-14,18H2,1-3H3,(H,29,34)(H,31,33)(H,32,35)/b30-17- |
| InChIKey | SRZLHMNQTNAZBO-LQNQUEJISA-N |
| XLogP | 3.44 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|