C29H32N4O6 — CID 126269057
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126269057) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126269057 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)N/N=C\c2ccccc2OCC(=O)Nc2cc(C)ccc2C)cc1OC |
| InChI | InChI=1S/C29H32N4O6/c1-19-9-10-20(2)23(15-19)32-27(34)18-39-24-8-6-5-7-22(24)17-31-33-29(36)28(35)30-14-13-21-11-12-25(37-3)26(16-21)38-4/h5-12,15-17H,13-14,18H2,1-4H3,(H,30,35)(H,32,34)(H,33,36)/b31-17- |
| InChIKey | GBPFZYDQWGXLBF-LJUMEUDFSA-N |
| XLogP | 3.15 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|