C25H23Cl2N3O2S — CID 3809207
[1-[(cyclohexylcarbamothioylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 3809207) has the molecular formula C25H23Cl2N3O2S and a molecular weight of 500.45 g/mol. Its IUPAC name is [1-[(cyclohexylcarbamothioylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[(cyclohexylcarbamothioylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3809207 |
| Molecular Formula | C25H23Cl2N3O2S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [1-[(cyclohexylcarbamothioylhydrazinylidene)methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1C=NNC(=S)NC1CCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H23Cl2N3O2S/c26-17-11-12-20(22(27)14-17)24(31)32-23-13-10-16-6-4-5-9-19(16)21(23)15-28-30-25(33)29-18-7-2-1-3-8-18/h4-6,9-15,18H,1-3,7-8H2,(H2,29,30,33) |
| InChIKey | NLKJIPQNBBGXRX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|