C21H21BrClN3O2S — CID 3535914
[4-bromo-2-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate (PubChem CID 3535914) has the molecular formula C21H21BrClN3O2S and a molecular weight of 494.84 g/mol. Its IUPAC name is [4-bromo-2-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-bromo-2-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 3535914 |
| Molecular Formula | C21H21BrClN3O2S |
| Molecular Weight | 494.84 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | [4-bromo-2-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(Oc1ccc(Br)cc1C=NNC(=S)NC1CCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C21H21BrClN3O2S/c22-15-10-11-19(28-20(27)17-8-4-5-9-18(17)23)14(12-15)13-24-26-21(29)25-16-6-2-1-3-7-16/h4-5,8-13,16H,1-3,6-7H2,(H2,25,26,29) |
| InChIKey | IWWRQUSJEPTONO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.84 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|