C23H18BrClN2O5 — CID 6036545
[4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 6036545) has the molecular formula C23H18BrClN2O5 and a molecular weight of 517.76 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6036545 |
| Molecular Formula | C23H18BrClN2O5 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | [4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc(Br)ccc2OC(=O)c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C23H18BrClN2O5/c1-30-20-9-7-14(12-21(20)31-2)22(28)27-26-13-15-11-16(24)8-10-19(15)32-23(29)17-5-3-4-6-18(17)25/h3-13H,1-2H3,(H,27,28)/b26-13- |
| InChIKey | XNXGDLSRNSGMQP-ZMFRSBBQSA-N |
| XLogP | 5.10 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|