C29H24Cl2N2O4 — CID 4200719
[1-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 4200719) has the molecular formula C29H24Cl2N2O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is [1-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4200719 |
| Molecular Formula | C29H24Cl2N2O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | [1-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | CC(C)c1ccc(OCC(=O)NN=Cc2c(OC(=O)c3ccc(Cl)cc3Cl)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H24Cl2N2O4/c1-18(2)19-7-11-22(12-8-19)36-17-28(34)33-32-16-25-23-6-4-3-5-20(23)9-14-27(25)37-29(35)24-13-10-21(30)15-26(24)31/h3-16,18H,17H2,1-2H3,(H,33,34) |
| InChIKey | GNEXLTLJHDXMAW-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|