C34H26Cl2N2O5 — CID 4691929
[1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate (PubChem CID 4691929) has the molecular formula C34H26Cl2N2O5 and a molecular weight of 613.50 g/mol. Its IUPAC name is [1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4691929 |
| Molecular Formula | C34H26Cl2N2O5 |
| Molecular Weight | 613.50 g/mol |
| Exact Mass | 612.12 |
| IUPAC Name | [1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| SMILES | CC(Oc1ccc(OCc2ccccc2)cc1)C(=O)NN=Cc1c(OC(=O)c2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C34H26Cl2N2O5/c1-22(42-27-15-13-26(14-16-27)41-21-23-7-3-2-4-8-23)33(39)38-37-20-30-28-10-6-5-9-24(28)11-18-32(30)43-34(40)29-17-12-25(35)19-31(29)36/h2-20,22H,21H2,1H3,(H,38,39) |
| InChIKey | RKNIKXJAONGRRQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.50 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|