C35H30N2O5 — CID 4077336
[1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate (PubChem CID 4077336) has the molecular formula C35H30N2O5 and a molecular weight of 558.63 g/mol. Its IUPAC name is [1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate.
| Compound Name | [1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
|---|---|
| PubChem CID | 4077336 |
| Molecular Formula | C35H30N2O5 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | [1-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]naphthalen-2-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc3ccccc3c2C=NNC(=O)C(C)Oc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C35H30N2O5/c1-24-9-8-13-28(21-24)35(39)42-33-20-15-27-12-6-7-14-31(27)32(33)22-36-37-34(38)25(2)41-30-18-16-29(17-19-30)40-23-26-10-4-3-5-11-26/h3-22,25H,23H2,1-2H3,(H,37,38) |
| InChIKey | QPTOATDTTBXXBO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|