C33H28N2O6 — CID 51060348
[1-[(E)-(2-naphthalen-1-yloxypropanoylhydrazinylidene)methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate (PubChem CID 51060348) has the molecular formula C33H28N2O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is [1-[(E)-(2-naphthalen-1-yloxypropanoylhydrazinylidene)methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate.
| Compound Name | [1-[(E)-(2-naphthalen-1-yloxypropanoylhydrazinylidene)methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 51060348 |
| Molecular Formula | C33H28N2O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | [1-[(E)-(2-naphthalen-1-yloxypropanoylhydrazinylidene)methyl]naphthalen-2-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2/C=N/NC(=O)C(C)Oc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C33H28N2O6/c1-21(40-28-14-8-11-22-9-5-7-13-26(22)28)32(36)35-34-20-27-25-12-6-4-10-23(25)15-17-29(27)41-33(37)24-16-18-30(38-2)31(19-24)39-3/h4-21H,1-3H3,(H,35,36)/b34-20+ |
| InChIKey | ROFAYAQBWYWCJB-QXUDOOCXSA-N |
| XLogP | 6.15 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|